C17H19ClN5O10P — CID 118202242
[5-chloro-3-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]-2,4-dihydroxyphenyl] dihydrogen phosphate (PubChem CID 118202242) has the molecular formula C17H19ClN5O10P and a molecular weight of 519.79 g/mol. Its IUPAC name is [5-chloro-3-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]-2,4-dihydroxyphenyl] dihydrogen phosphate.
| Compound Name | [5-chloro-3-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]-2,4-dihydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118202242 |
| Molecular Formula | C17H19ClN5O10P |
| Molecular Weight | 519.79 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | [5-chloro-3-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]-2,4-dihydroxyphenyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1cc(Cl)c(O)c(CNc2ncnc3c2ncn3[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1O |
| InChI | InChI=1S/C17H19ClN5O10P/c18-7-1-8(33-34(29,30)31)12(26)6(11(7)25)2-19-15-10-16(21-4-20-15)23(5-22-10)17-14(28)13(27)9(3-24)32-17/h1,4-5,9,13-14,17,24-28H,2-3H2,(H,19,20,21)(H2,29,30,31)/t9-,13-,14-,17-/m1/s1 |
| InChIKey | OPXFFSFITDZRNK-KRQFVHPKSA-N |
| XLogP | -0.41 |
| TPSA | 232.77 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.79 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|