C17H18Cl2N5O8P — CID 118202246
[3,4-dichloro-5-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]phenyl] dihydrogen phosphate (PubChem CID 118202246) has the molecular formula C17H18Cl2N5O8P and a molecular weight of 522.24 g/mol. Its IUPAC name is [3,4-dichloro-5-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]phenyl] dihydrogen phosphate.
| Compound Name | [3,4-dichloro-5-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118202246 |
| Molecular Formula | C17H18Cl2N5O8P |
| Molecular Weight | 522.24 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | [3,4-dichloro-5-[[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]methyl]phenyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1cc(Cl)c(Cl)c(CNc2ncnc3c2ncn3[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C17H18Cl2N5O8P/c18-9-2-8(32-33(28,29)30)1-7(11(9)19)3-20-15-12-16(22-5-21-15)24(6-23-12)17-14(27)13(26)10(4-25)31-17/h1-2,5-6,10,13-14,17,25-27H,3-4H2,(H,20,21,22)(H2,28,29,30)/t10-,13-,14-,17-/m1/s1 |
| InChIKey | KPEVSFCPVVSNPF-IWCJZZDYSA-N |
| XLogP | 0.83 |
| TPSA | 192.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|