C11H15N — CID 118203501
3-propan-2-yl-5,6-dihydro-1H-indole (PubChem CID 118203501) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 3-propan-2-yl-5,6-dihydro-1H-indole.
| Compound Name | 3-propan-2-yl-5,6-dihydro-1H-indole |
|---|---|
| PubChem CID | 118203501 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 3-propan-2-yl-5,6-dihydro-1H-indole |
| SMILES | CC(C)c1c[nH]c2c1=CCCC=2 |
| InChI | InChI=1S/C11H15N/c1-8(2)10-7-12-11-6-4-3-5-9(10)11/h5-8,12H,3-4H2,1-2H3 |
| InChIKey | FMFMCOSTAZGAFW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |