C14H27NO6 — CID 118204328
methyl (3S)-2,2-dimethoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 118204328) has the molecular formula C14H27NO6 and a molecular weight of 305.37 g/mol. Its IUPAC name is methyl (3S)-2,2-dimethoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | methyl (3S)-2,2-dimethoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 118204328 |
| Molecular Formula | C14H27NO6 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | methyl (3S)-2,2-dimethoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CCC[C@H](NC(=O)OC(C)(C)C)C(OC)(OC)C(=O)OC |
| InChI | InChI=1S/C14H27NO6/c1-8-9-10(15-12(17)21-13(2,3)4)14(19-6,20-7)11(16)18-5/h10H,8-9H2,1-7H3,(H,15,17)/t10-/m0/s1 |
| InChIKey | GUNYIRBHFRGLMQ-JTQLQIEISA-N |
| XLogP | 1.84 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|