C15H27NO9S — CID 142787517
dimethyl 2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-2-methylsulfonyloxypropanedioate (PubChem CID 142787517) has the molecular formula C15H27NO9S and a molecular weight of 397.45 g/mol. Its IUPAC name is dimethyl 2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-2-methylsulfonyloxypropanedioate.
| Compound Name | dimethyl 2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-2-methylsulfonyloxypropanedioate |
|---|---|
| PubChem CID | 142787517 |
| Molecular Formula | C15H27NO9S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | dimethyl 2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-2-methylsulfonyloxypropanedioate |
| SMILES | CCCC(NC(=O)OC(C)(C)C)C(OS(C)(=O)=O)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C15H27NO9S/c1-8-9-10(16-13(19)24-14(2,3)4)15(11(17)22-5,12(18)23-6)25-26(7,20)21/h10H,8-9H2,1-7H3,(H,16,19) |
| InChIKey | VAQKDRLMYUNRGR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|