C23H16F3N3O5S — CID 118205023
N-(7-cyclopropyl-1,3-dioxo-2-pyridin-3-ylisoindol-4-yl)-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 118205023) has the molecular formula C23H16F3N3O5S and a molecular weight of 503.46 g/mol. Its IUPAC name is N-(7-cyclopropyl-1,3-dioxo-2-pyridin-3-ylisoindol-4-yl)-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(7-cyclopropyl-1,3-dioxo-2-pyridin-3-ylisoindol-4-yl)-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 118205023 |
| Molecular Formula | C23H16F3N3O5S |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | N-(7-cyclopropyl-1,3-dioxo-2-pyridin-3-ylisoindol-4-yl)-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=C1c2c(NS(=O)(=O)c3ccc(OC(F)(F)F)cc3)ccc(C3CC3)c2C(=O)N1c1cccnc1 |
| InChI | InChI=1S/C23H16F3N3O5S/c24-23(25,26)34-15-5-7-16(8-6-15)35(32,33)28-18-10-9-17(13-3-4-13)19-20(18)22(31)29(21(19)30)14-2-1-11-27-12-14/h1-2,5-13,28H,3-4H2 |
| InChIKey | XLYKIUKZYNFJQD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|