C21H14ClF3N3O7S+ — CID 123627994
N-[7-chloro-2-(1-hydroxy-5-methoxypyridin-1-ium-3-yl)-1,3-dioxoisoindol-4-yl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 123627994) has the molecular formula C21H14ClF3N3O7S+ and a molecular weight of 544.87 g/mol. Its IUPAC name is N-[7-chloro-2-(1-hydroxy-5-methoxypyridin-1-ium-3-yl)-1,3-dioxoisoindol-4-yl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[7-chloro-2-(1-hydroxy-5-methoxypyridin-1-ium-3-yl)-1,3-dioxoisoindol-4-yl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 123627994 |
| Molecular Formula | C21H14ClF3N3O7S+ |
| Molecular Weight | 544.87 g/mol |
| Exact Mass | 544.02 |
| IUPAC Name | N-[7-chloro-2-(1-hydroxy-5-methoxypyridin-1-ium-3-yl)-1,3-dioxoisoindol-4-yl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | COc1cc(N2C(=O)c3c(Cl)ccc(NS(=O)(=O)c4ccc(OC(F)(F)F)cc4)c3C2=O)c[n+](O)c1 |
| InChI | InChI=1S/C21H13ClF3N3O7S/c1-34-13-8-11(9-27(31)10-13)28-19(29)17-15(22)6-7-16(18(17)20(28)30)26-36(32,33)14-4-2-12(3-5-14)35-21(23,24)25/h2-10H,1H3,(H-,26,30,31)/p+1 |
| InChIKey | GQCOHXPFIPAEOA-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.87 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|