C18H21F3N2O3 — CID 11820920
(E)-1-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]-N-(2,2,2-trifluoroethoxy)methanimine (PubChem CID 11820920) has the molecular formula C18H21F3N2O3 and a molecular weight of 370.37 g/mol. Its IUPAC name is (E)-1-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]-N-(2,2,2-trifluoroethoxy)methanimine.
| Compound Name | (E)-1-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]-N-(2,2,2-trifluoroethoxy)methanimine |
|---|---|
| PubChem CID | 11820920 |
| Molecular Formula | C18H21F3N2O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (E)-1-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]-N-(2,2,2-trifluoroethoxy)methanimine |
| SMILES | Cc1cc(CCCOc2c(C)cc(/C=N/OCC(F)(F)F)cc2C)on1 |
| InChI | InChI=1S/C18H21F3N2O3/c1-12-7-15(10-22-25-11-18(19,20)21)8-13(2)17(12)24-6-4-5-16-9-14(3)23-26-16/h7-10H,4-6,11H2,1-3H3/b22-10+ |
| InChIKey | WCBFVBSJAJAOSG-LSHDLFTRSA-N |
| XLogP | 4.52 |
| TPSA | 56.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|