C9H16S — CID 118210351
7-thiabicyclo[4.2.2]decane (PubChem CID 118210351) has the molecular formula C9H16S and a molecular weight of 156.29 g/mol. Its IUPAC name is 7-thiabicyclo[4.2.2]decane.
| Compound Name | 7-thiabicyclo[4.2.2]decane |
|---|---|
| PubChem CID | 118210351 |
| Molecular Formula | C9H16S |
| Molecular Weight | 156.29 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 7-thiabicyclo[4.2.2]decane |
| SMILES | C1CCC2CCC(C1)CS2 |
| InChI | InChI=1S/C9H16S/c1-2-4-9-6-5-8(3-1)7-10-9/h8-9H,1-7H2 |
| InChIKey | WTRQONSHAAJIOQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |