C14H22O4 — CID 11821135
(1S,4S,9S,12S)-2,3,17-trioxatetracyclo[7.7.1.01,12.04,9]heptadecan-4-ol (PubChem CID 11821135) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (1S,4S,9S,12S)-2,3,17-trioxatetracyclo[7.7.1.01,12.04,9]heptadecan-4-ol.
| Compound Name | (1S,4S,9S,12S)-2,3,17-trioxatetracyclo[7.7.1.01,12.04,9]heptadecan-4-ol |
|---|---|
| PubChem CID | 11821135 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (1S,4S,9S,12S)-2,3,17-trioxatetracyclo[7.7.1.01,12.04,9]heptadecan-4-ol |
| SMILES | O[C@]12CCCC[C@]13CC[C@@H]1CCCC[C@@]1(OO2)O3 |
| InChI | InChI=1S/C14H22O4/c15-14-9-4-3-7-12(14)10-6-11-5-1-2-8-13(11,16-12)17-18-14/h11,15H,1-10H2/t11-,12-,13-,14-/m0/s1 |
| InChIKey | ALBFSBSHWPNRND-XUXIUFHCSA-N |
| XLogP | 2.65 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|