C20H30O3 — CID 129445496
(1S,6S,8R,12S,14S,19R,22R)-20,21-dioxahexacyclo[10.8.2.01,6.08,19.08,22.014,19]docosan-22-ol (PubChem CID 129445496) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,6S,8R,12S,14S,19R,22R)-20,21-dioxahexacyclo[10.8.2.01,6.08,19.08,22.014,19]docosan-22-ol.
| Compound Name | (1S,6S,8R,12S,14S,19R,22R)-20,21-dioxahexacyclo[10.8.2.01,6.08,19.08,22.014,19]docosan-22-ol |
|---|---|
| PubChem CID | 129445496 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1S,6S,8R,12S,14S,19R,22R)-20,21-dioxahexacyclo[10.8.2.01,6.08,19.08,22.014,19]docosan-22-ol |
| SMILES | O[C@]12O[C@@]34CCCC[C@H]3C[C@@]13CCC[C@H]2C[C@@H]1CCCC[C@@]13O4 |
| InChI | InChI=1S/C20H30O3/c21-20-15-8-5-9-17(20)13-16-7-2-4-11-19(16,23-20)22-18(17)10-3-1-6-14(18)12-15/h14-16,21H,1-13H2/t14-,15-,16-,17+,18+,19-,20+/m0/s1 |
| InChIKey | GMYSGDXPXKUMOX-NRVHICEFSA-N |
| XLogP | 4.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |