C19H28O3 — CID 98064522
(1S,6R,8S,11R,13S,18S,21S)-19,20-dioxahexacyclo[9.8.2.01,6.08,18.08,21.013,18]henicosan-21-ol (PubChem CID 98064522) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (1S,6R,8S,11R,13S,18S,21S)-19,20-dioxahexacyclo[9.8.2.01,6.08,18.08,21.013,18]henicosan-21-ol.
| Compound Name | (1S,6R,8S,11R,13S,18S,21S)-19,20-dioxahexacyclo[9.8.2.01,6.08,18.08,21.013,18]henicosan-21-ol |
|---|---|
| PubChem CID | 98064522 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (1S,6R,8S,11R,13S,18S,21S)-19,20-dioxahexacyclo[9.8.2.01,6.08,18.08,21.013,18]henicosan-21-ol |
| SMILES | O[C@@]12O[C@@]34CCCC[C@@H]3C[C@]13CC[C@@H]2C[C@@H]1CCCC[C@]13O4 |
| InChI | InChI=1S/C19H28O3/c20-19-14-7-10-16(19)12-15-6-2-4-9-18(15,22-19)21-17(16)8-3-1-5-13(17)11-14/h13-15,20H,1-12H2/t13-,14+,15+,16-,17-,18-,19-/m0/s1 |
| InChIKey | NYWUQKFITQFOEY-WHZXTZRYSA-N |
| XLogP | 3.74 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |