C14H22O3 — CID 40507554
(1S,4R,9S,11S)-10,16-dioxatetracyclo[7.6.1.01,11.04,9]hexadecan-11-ol (PubChem CID 40507554) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (1S,4R,9S,11S)-10,16-dioxatetracyclo[7.6.1.01,11.04,9]hexadecan-11-ol.
| Compound Name | (1S,4R,9S,11S)-10,16-dioxatetracyclo[7.6.1.01,11.04,9]hexadecan-11-ol |
|---|---|
| PubChem CID | 40507554 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (1S,4R,9S,11S)-10,16-dioxatetracyclo[7.6.1.01,11.04,9]hexadecan-11-ol |
| SMILES | O[C@]12CCCC[C@]13CC[C@H]1CCCC[C@]1(O3)O2 |
| InChI | InChI=1S/C14H22O3/c15-14-9-4-3-7-12(14)10-6-11-5-1-2-8-13(11,16-12)17-14/h11,15H,1-10H2/t11-,12+,13+,14+/m1/s1 |
| InChIKey | UMKPCRWEPQJTQJ-RFGFWPKPSA-N |
| XLogP | 2.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |