C15H20O4 — CID 11821489
(9R)-3,5,9-trimethyl-2-methylidene-12,13-dioxatricyclo[7.3.1.01,6]trideca-3,5-diene-4,7-diol (PubChem CID 11821489) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (9R)-3,5,9-trimethyl-2-methylidene-12,13-dioxatricyclo[7.3.1.01,6]trideca-3,5-diene-4,7-diol.
| Compound Name | (9R)-3,5,9-trimethyl-2-methylidene-12,13-dioxatricyclo[7.3.1.01,6]trideca-3,5-diene-4,7-diol |
|---|---|
| PubChem CID | 11821489 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (9R)-3,5,9-trimethyl-2-methylidene-12,13-dioxatricyclo[7.3.1.01,6]trideca-3,5-diene-4,7-diol |
| SMILES | C=C1C(C)=C(O)C(C)=C2C(O)C[C@@]3(C)CCOC12O3 |
| InChI | InChI=1S/C15H20O4/c1-8-10(3)15-12(9(2)13(8)17)11(16)7-14(4,19-15)5-6-18-15/h11,16-17H,3,5-7H2,1-2,4H3/t11?,14-,15?/m1/s1 |
| InChIKey | QYPYVSCFTUDWBI-XGTXGMFGSA-N |
| XLogP | 2.36 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |