C8H11BrO3 — CID 53474575
(7S)-9-bromo-8-methyl-1,4-dioxaspiro[4.4]non-8-en-7-ol (PubChem CID 53474575) has the molecular formula C8H11BrO3 and a molecular weight of 235.08 g/mol. Its IUPAC name is (7S)-9-bromo-8-methyl-1,4-dioxaspiro[4.4]non-8-en-7-ol.
| Compound Name | (7S)-9-bromo-8-methyl-1,4-dioxaspiro[4.4]non-8-en-7-ol |
|---|---|
| PubChem CID | 53474575 |
| Molecular Formula | C8H11BrO3 |
| Molecular Weight | 235.08 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | (7S)-9-bromo-8-methyl-1,4-dioxaspiro[4.4]non-8-en-7-ol |
| SMILES | CC1=C(Br)C2(C[C@@H]1O)OCCO2 |
| InChI | InChI=1S/C8H11BrO3/c1-5-6(10)4-8(7(5)9)11-2-3-12-8/h6,10H,2-4H2,1H3/t6-/m0/s1 |
| InChIKey | LRADLQORFFDYMG-LURJTMIESA-N |
| XLogP | 1.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.08 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |