C13H22N2O2S — CID 118238455
tert-butyl 6-sulfanylidene-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 118238455) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is tert-butyl 6-sulfanylidene-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 6-sulfanylidene-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 118238455 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | tert-butyl 6-sulfanylidene-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCNC2)C(=S)C1 |
| InChI | InChI=1S/C13H22N2O2S/c1-12(2,3)17-11(16)15-7-5-13(10(18)8-15)4-6-14-9-13/h14H,4-9H2,1-3H3 |
| InChIKey | BPIDOSYCDJGCKV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|