C22H38N2O3 — CID 11825031
(2R,4aS,4bS,7S,8aR,10aR)-2-[(2S,4E)-4-(2-aminoethoxyimino)butan-2-yl]-7-hydroxy-2,4b-dimethyl-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-1-one (PubChem CID 11825031) has the molecular formula C22H38N2O3 and a molecular weight of 378.56 g/mol. Its IUPAC name is (2R,4aS,4bS,7S,8aR,10aR)-2-[(2S,4E)-4-(2-aminoethoxyimino)butan-2-yl]-7-hydroxy-2,4b-dimethyl-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-1-one.
| Compound Name | (2R,4aS,4bS,7S,8aR,10aR)-2-[(2S,4E)-4-(2-aminoethoxyimino)butan-2-yl]-7-hydroxy-2,4b-dimethyl-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-1-one |
|---|---|
| PubChem CID | 11825031 |
| Molecular Formula | C22H38N2O3 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | (2R,4aS,4bS,7S,8aR,10aR)-2-[(2S,4E)-4-(2-aminoethoxyimino)butan-2-yl]-7-hydroxy-2,4b-dimethyl-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-1-one |
| SMILES | C[C@@H](C/C=N/OCCN)[C@@]1(C)CC[C@H]2[C@@H](CC[C@@H]3C[C@@H](O)CC[C@@]32C)C1=O |
| InChI | InChI=1S/C22H38N2O3/c1-15(8-12-24-27-13-11-23)21(2)10-7-19-18(20(21)26)5-4-16-14-17(25)6-9-22(16,19)3/h12,15-19,25H,4-11,13-14,23H2,1-3H3/b24-12+/t15-,16+,17-,18+,19-,21+,22-/m0/s1 |
| InChIKey | DCXOCWYTNAVQBU-LRORJHMASA-N |
| XLogP | 3.54 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|