C23H40N2O3 — CID 15383577
(2R,4aS,4bS,7S,8aR,10aR)-2-[(1E,3R)-1-(2-aminoethoxyimino)pentan-3-yl]-7-hydroxy-2,4b-dimethyl-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-1-one (PubChem CID 15383577) has the molecular formula C23H40N2O3 and a molecular weight of 392.58 g/mol. Its IUPAC name is (2R,4aS,4bS,7S,8aR,10aR)-2-[(1E,3R)-1-(2-aminoethoxyimino)pentan-3-yl]-7-hydroxy-2,4b-dimethyl-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-1-one.
| Compound Name | (2R,4aS,4bS,7S,8aR,10aR)-2-[(1E,3R)-1-(2-aminoethoxyimino)pentan-3-yl]-7-hydroxy-2,4b-dimethyl-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-1-one |
|---|---|
| PubChem CID | 15383577 |
| Molecular Formula | C23H40N2O3 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.30 |
| IUPAC Name | (2R,4aS,4bS,7S,8aR,10aR)-2-[(1E,3R)-1-(2-aminoethoxyimino)pentan-3-yl]-7-hydroxy-2,4b-dimethyl-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-1-one |
| SMILES | CC[C@H](C/C=N/OCCN)[C@@]1(C)CC[C@H]2[C@@H](CC[C@@H]3C[C@@H](O)CC[C@@]32C)C1=O |
| InChI | InChI=1S/C23H40N2O3/c1-4-16(9-13-25-28-14-12-24)23(3)11-8-20-19(21(23)27)6-5-17-15-18(26)7-10-22(17,20)2/h13,16-20,26H,4-12,14-15,24H2,1-3H3/b25-13+/t16-,17-,18+,19-,20+,22+,23-/m1/s1 |
| InChIKey | LQVQTKIMPALRSS-GDJVTJTBSA-N |
| XLogP | 3.93 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|