C23H34O3 — CID 67574251
(2R,4aS,4bS,7S,8aR,10aR)-2-[1-(furan-3-yl)propyl]-7-hydroxy-2,4b-dimethyl-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-1-one (PubChem CID 67574251) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (2R,4aS,4bS,7S,8aR,10aR)-2-[1-(furan-3-yl)propyl]-7-hydroxy-2,4b-dimethyl-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-1-one.
| Compound Name | (2R,4aS,4bS,7S,8aR,10aR)-2-[1-(furan-3-yl)propyl]-7-hydroxy-2,4b-dimethyl-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-1-one |
|---|---|
| PubChem CID | 67574251 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (2R,4aS,4bS,7S,8aR,10aR)-2-[1-(furan-3-yl)propyl]-7-hydroxy-2,4b-dimethyl-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-1-one |
| SMILES | CCC(c1ccoc1)[C@@]1(C)CC[C@H]2[C@@H](CC[C@@H]3C[C@@H](O)CC[C@@]32C)C1=O |
| InChI | InChI=1S/C23H34O3/c1-4-19(15-9-12-26-14-15)23(3)11-8-20-18(21(23)25)6-5-16-13-17(24)7-10-22(16,20)2/h9,12,14,16-20,24H,4-8,10-11,13H2,1-3H3/t16-,17+,18-,19?,20+,22+,23-/m1/s1 |
| InChIKey | HGILJSZUUBYCCN-KHFCXAIZSA-N |
| XLogP | 5.34 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |