C25H44N2O3 — CID 91587321
(2R,4aS,4bS,10aR)-2-[1-[2-(dimethylamino)ethoxyimino]pentan-3-yl]-7-hydroxy-2,4b-dimethyl-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-1-one (PubChem CID 91587321) has the molecular formula C25H44N2O3 and a molecular weight of 420.64 g/mol. Its IUPAC name is (2R,4aS,4bS,10aR)-2-[1-[2-(dimethylamino)ethoxyimino]pentan-3-yl]-7-hydroxy-2,4b-dimethyl-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-1-one.
| Compound Name | (2R,4aS,4bS,10aR)-2-[1-[2-(dimethylamino)ethoxyimino]pentan-3-yl]-7-hydroxy-2,4b-dimethyl-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-1-one |
|---|---|
| PubChem CID | 91587321 |
| Molecular Formula | C25H44N2O3 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.34 |
| IUPAC Name | (2R,4aS,4bS,10aR)-2-[1-[2-(dimethylamino)ethoxyimino]pentan-3-yl]-7-hydroxy-2,4b-dimethyl-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-1-one |
| SMILES | CCC(CC=NOCCN(C)C)[C@@]1(C)CC[C@H]2[C@@H](CCC3CC(O)CC[C@@]32C)C1=O |
| InChI | InChI=1S/C25H44N2O3/c1-6-18(11-14-26-30-16-15-27(4)5)25(3)13-10-22-21(23(25)29)8-7-19-17-20(28)9-12-24(19,22)2/h14,18-22,28H,6-13,15-17H2,1-5H3/t18?,19?,20?,21-,22+,24+,25-/m1/s1 |
| InChIKey | DUBHNQVGESAENE-OWWTZKGDSA-N |
| XLogP | 4.53 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|