C14H19NO2 — CID 118258993
5-tert-butyl-3-ethyl-7-methyl-1,3-benzoxazol-2-one (PubChem CID 118258993) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 5-tert-butyl-3-ethyl-7-methyl-1,3-benzoxazol-2-one.
| Compound Name | 5-tert-butyl-3-ethyl-7-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 118258993 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 5-tert-butyl-3-ethyl-7-methyl-1,3-benzoxazol-2-one |
| SMILES | CCn1c(=O)oc2c(C)cc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C14H19NO2/c1-6-15-11-8-10(14(3,4)5)7-9(2)12(11)17-13(15)16/h7-8H,6H2,1-5H3 |
| InChIKey | HLXNEVBVSWYXLX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |