C31H32N2O — CID 11826463
(1R,9S,13R)-4-(benzhydrylideneamino)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one (PubChem CID 11826463) has the molecular formula C31H32N2O and a molecular weight of 448.61 g/mol. Its IUPAC name is (1R,9S,13R)-4-(benzhydrylideneamino)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one.
| Compound Name | (1R,9S,13R)-4-(benzhydrylideneamino)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 11826463 |
| Molecular Formula | C31H32N2O |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | (1R,9S,13R)-4-(benzhydrylideneamino)-10-(cyclopropylmethyl)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
| SMILES | C[C@H]1[C@H]2C(=O)c3ccc(N=C(c4ccccc4)c4ccccc4)cc3[C@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C31H32N2O/c1-21-29-30(34)26-16-15-25(19-27(26)31(21,2)17-18-33(29)20-22-13-14-22)32-28(23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-12,15-16,19,21-22,29H,13-14,17-18,20H2,1-2H3/t21-,29-,31+/m0/s1 |
| InChIKey | BGOMKMZERUZBNY-GYRATPHVSA-N |
| XLogP | 6.43 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|