C26H32N2O — CID 130396055
(1S,9S,14R)-4-(benzylamino)-10-(cyclopropylmethyl)-1,14-dimethyl-10-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-8-one (PubChem CID 130396055) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is (1S,9S,14R)-4-(benzylamino)-10-(cyclopropylmethyl)-1,14-dimethyl-10-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-8-one.
| Compound Name | (1S,9S,14R)-4-(benzylamino)-10-(cyclopropylmethyl)-1,14-dimethyl-10-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 130396055 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (1S,9S,14R)-4-(benzylamino)-10-(cyclopropylmethyl)-1,14-dimethyl-10-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-8-one |
| SMILES | C[C@H]1[C@H]2C(=O)c3ccc(NCc4ccccc4)cc3[C@@]1(C)CCCN2CC1CC1 |
| InChI | InChI=1S/C26H32N2O/c1-18-24-25(29)22-12-11-21(27-16-19-7-4-3-5-8-19)15-23(22)26(18,2)13-6-14-28(24)17-20-9-10-20/h3-5,7-8,11-12,15,18,20,24,27H,6,9-10,13-14,16-17H2,1-2H3/t18-,24-,26-/m0/s1 |
| InChIKey | OYSRBNIMQNLAAU-SQOVJYTMSA-N |
| XLogP | 5.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |