C19H22N2O — CID 140767726
(1R,13R)-10-(cyclopropylmethyl)-4-isocyano-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one (PubChem CID 140767726) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (1R,13R)-10-(cyclopropylmethyl)-4-isocyano-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one.
| Compound Name | (1R,13R)-10-(cyclopropylmethyl)-4-isocyano-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 140767726 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (1R,13R)-10-(cyclopropylmethyl)-4-isocyano-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
| SMILES | [C-]#[N+]c1ccc2c(c1)[C@]1(C)CCN(CC3CC3)C(C2=O)[C@@H]1C |
| InChI | InChI=1S/C19H22N2O/c1-12-17-18(22)15-7-6-14(20-3)10-16(15)19(12,2)8-9-21(17)11-13-4-5-13/h6-7,10,12-13,17H,4-5,8-9,11H2,1-2H3/t12-,17?,19+/m0/s1 |
| InChIKey | IGPLMYAXEVNRBJ-HIFNOKKUSA-N |
| XLogP | 3.81 |
| TPSA | 24.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|