C35H51ClN2O7 — CID 126483071
(1R,9S,13R)-10-(cyclopropylmethyl)-4-[4-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]anilino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one;hydrochloride (PubChem CID 126483071) has the molecular formula C35H51ClN2O7 and a molecular weight of 647.25 g/mol. Its IUPAC name is (1R,9S,13R)-10-(cyclopropylmethyl)-4-[4-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]anilino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one;hydrochloride.
| Compound Name | (1R,9S,13R)-10-(cyclopropylmethyl)-4-[4-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]anilino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one;hydrochloride |
|---|---|
| PubChem CID | 126483071 |
| Molecular Formula | C35H51ClN2O7 |
| Molecular Weight | 647.25 g/mol |
| Exact Mass | 646.34 |
| IUPAC Name | (1R,9S,13R)-10-(cyclopropylmethyl)-4-[4-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]anilino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one;hydrochloride |
| SMILES | COCCOCCOCCOCCOCCOc1ccc(Nc2ccc3c(c2)[C@]2(C)CCN(CC4CC4)[C@H](C3=O)[C@@H]2C)cc1.Cl |
| InChI | InChI=1S/C35H50N2O7.ClH/c1-26-33-34(38)31-11-8-29(24-32(31)35(26,2)12-13-37(33)25-27-4-5-27)36-28-6-9-30(10-7-28)44-23-22-43-21-20-42-19-18-41-17-16-40-15-14-39-3;/h6-11,24,26-27,33,36H,4-5,12-23,25H2,1-3H3;1H/t26-,33-,35+;/m0./s1 |
| InChIKey | AXKOYWQSEQPRJH-OWZZSSLLSA-N |
| XLogP | 5.52 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.25 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|