C29H38N2O3 — CID 146975059
(1R,13R)-10-(cyclopropylmethyl)-4-[4-(4-methoxybutan-2-yloxy)anilino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one (PubChem CID 146975059) has the molecular formula C29H38N2O3 and a molecular weight of 462.63 g/mol. Its IUPAC name is (1R,13R)-10-(cyclopropylmethyl)-4-[4-(4-methoxybutan-2-yloxy)anilino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one.
| Compound Name | (1R,13R)-10-(cyclopropylmethyl)-4-[4-(4-methoxybutan-2-yloxy)anilino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 146975059 |
| Molecular Formula | C29H38N2O3 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | (1R,13R)-10-(cyclopropylmethyl)-4-[4-(4-methoxybutan-2-yloxy)anilino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
| SMILES | COCCC(C)Oc1ccc(Nc2ccc3c(c2)[C@]2(C)CCN(CC4CC4)C(C3=O)[C@@H]2C)cc1 |
| InChI | InChI=1S/C29H38N2O3/c1-19(13-16-33-4)34-24-10-7-22(8-11-24)30-23-9-12-25-26(17-23)29(3)14-15-31(18-21-5-6-21)27(20(29)2)28(25)32/h7-12,17,19-21,27,30H,5-6,13-16,18H2,1-4H3/t19?,20-,27?,29+/m0/s1 |
| InChIKey | ANEKSNVVEBNQNA-IXGCZSIFSA-N |
| XLogP | 5.81 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |