C36H52N2O6 — CID 147837100
(1R,13R)-10-(cyclopropylmethyl)-4-[2-[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]propyl]anilino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one (PubChem CID 147837100) has the molecular formula C36H52N2O6 and a molecular weight of 608.82 g/mol. Its IUPAC name is (1R,13R)-10-(cyclopropylmethyl)-4-[2-[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]propyl]anilino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one.
| Compound Name | (1R,13R)-10-(cyclopropylmethyl)-4-[2-[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]propyl]anilino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 147837100 |
| Molecular Formula | C36H52N2O6 |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.38 |
| IUPAC Name | (1R,13R)-10-(cyclopropylmethyl)-4-[2-[3-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]propyl]anilino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
| SMILES | COCCOCCOCCOCCOCCCc1ccccc1Nc1ccc2c(c1)[C@]1(C)CCN(CC3CC3)C(C2=O)[C@@H]1C |
| InChI | InChI=1S/C36H52N2O6/c1-27-34-35(39)31-13-12-30(25-32(31)36(27,2)14-15-38(34)26-28-10-11-28)37-33-9-5-4-7-29(33)8-6-16-41-19-20-43-23-24-44-22-21-42-18-17-40-3/h4-5,7,9,12-13,25,27-28,34,37H,6,8,10-11,14-24,26H2,1-3H3/t27-,34?,36+/m0/s1 |
| InChIKey | HSFUDRHYNBQKKL-GLPZOKSMSA-N |
| XLogP | 5.65 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|