C21H29NO4 — CID 126493029
(1R,13R)-10-(cyclopropylmethyl)-4-hydroxy-3-(2-methoxyethoxy)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one (PubChem CID 126493029) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is (1R,13R)-10-(cyclopropylmethyl)-4-hydroxy-3-(2-methoxyethoxy)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one.
| Compound Name | (1R,13R)-10-(cyclopropylmethyl)-4-hydroxy-3-(2-methoxyethoxy)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 126493029 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | (1R,13R)-10-(cyclopropylmethyl)-4-hydroxy-3-(2-methoxyethoxy)-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
| SMILES | COCCOc1c(O)ccc2c1[C@]1(C)CCN(CC3CC3)C(C2=O)[C@@H]1C |
| InChI | InChI=1S/C21H29NO4/c1-13-18-19(24)15-6-7-16(23)20(26-11-10-25-3)17(15)21(13,2)8-9-22(18)12-14-4-5-14/h6-7,13-14,18,23H,4-5,8-12H2,1-3H3/t13-,18?,21+/m0/s1 |
| InChIKey | PMUHWQMYPLFWJN-MVDNPXKASA-N |
| XLogP | 2.99 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|