C23H30O5Se — CID 11826724
[(1S,3aS,4R,5S,6aS)-3a-methyl-3,6-dioxo-5-phenylselanyl-4-propan-2-yl-1,4,5,6a-tetrahydrocyclopenta[c]furan-1-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11826724) has the molecular formula C23H30O5Se and a molecular weight of 465.45 g/mol. Its IUPAC name is [(1S,3aS,4R,5S,6aS)-3a-methyl-3,6-dioxo-5-phenylselanyl-4-propan-2-yl-1,4,5,6a-tetrahydrocyclopenta[c]furan-1-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1S,3aS,4R,5S,6aS)-3a-methyl-3,6-dioxo-5-phenylselanyl-4-propan-2-yl-1,4,5,6a-tetrahydrocyclopenta[c]furan-1-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11826724 |
| Molecular Formula | C23H30O5Se |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | [(1S,3aS,4R,5S,6aS)-3a-methyl-3,6-dioxo-5-phenylselanyl-4-propan-2-yl-1,4,5,6a-tetrahydrocyclopenta[c]furan-1-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)[C@H]1[C@H]([Se]c2ccccc2)C(=O)[C@@H]2[C@@H](COC(=O)C(C)(C)C)OC(=O)[C@@]21C |
| InChI | InChI=1S/C23H30O5Se/c1-13(2)16-19(29-14-10-8-7-9-11-14)18(24)17-15(28-21(26)23(16,17)6)12-27-20(25)22(3,4)5/h7-11,13,15-17,19H,12H2,1-6H3/t15-,16+,17+,19+,23-/m1/s1 |
| InChIKey | KNPMXJZCSHOBMX-UTJZJXFBSA-N |
| XLogP | 2.80 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|