C24H27NO5S3 — CID 11827282
4-(1,3-dithian-2-yl)-1-[(4-methoxyphenyl)methyl]-3-(4-methylphenyl)sulfonylpiperidine-2,6-dione (PubChem CID 11827282) has the molecular formula C24H27NO5S3 and a molecular weight of 505.68 g/mol. Its IUPAC name is 4-(1,3-dithian-2-yl)-1-[(4-methoxyphenyl)methyl]-3-(4-methylphenyl)sulfonylpiperidine-2,6-dione.
| Compound Name | 4-(1,3-dithian-2-yl)-1-[(4-methoxyphenyl)methyl]-3-(4-methylphenyl)sulfonylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 11827282 |
| Molecular Formula | C24H27NO5S3 |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 4-(1,3-dithian-2-yl)-1-[(4-methoxyphenyl)methyl]-3-(4-methylphenyl)sulfonylpiperidine-2,6-dione |
| SMILES | COc1ccc(CN2C(=O)CC(C3SCCCS3)C(S(=O)(=O)c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H27NO5S3/c1-16-4-10-19(11-5-16)33(28,29)22-20(24-31-12-3-13-32-24)14-21(26)25(23(22)27)15-17-6-8-18(30-2)9-7-17/h4-11,20,22,24H,3,12-15H2,1-2H3 |
| InChIKey | NRWTYBZJOHARKN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|