C30H35N5O4 — CID 118273080
(6S,9S,9aS)-6-(4-aminobutyl)-N-benzyl-9-methyl-8-(naphthalen-1-ylmethyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxamide (PubChem CID 118273080) has the molecular formula C30H35N5O4 and a molecular weight of 529.64 g/mol. Its IUPAC name is (6S,9S,9aS)-6-(4-aminobutyl)-N-benzyl-9-methyl-8-(naphthalen-1-ylmethyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxamide.
| Compound Name | (6S,9S,9aS)-6-(4-aminobutyl)-N-benzyl-9-methyl-8-(naphthalen-1-ylmethyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxamide |
|---|---|
| PubChem CID | 118273080 |
| Molecular Formula | C30H35N5O4 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | (6S,9S,9aS)-6-(4-aminobutyl)-N-benzyl-9-methyl-8-(naphthalen-1-ylmethyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxamide |
| SMILES | C[C@H]1[C@@H]2N(C(=O)NCc3ccccc3)OCC(=O)N2[C@@H](CCCCN)C(=O)N1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C30H35N5O4/c1-21-28-34(27(36)20-39-35(28)30(38)32-18-22-10-3-2-4-11-22)26(16-7-8-17-31)29(37)33(21)19-24-14-9-13-23-12-5-6-15-25(23)24/h2-6,9-15,21,26,28H,7-8,16-20,31H2,1H3,(H,32,38)/t21-,26-,28-/m0/s1 |
| InChIKey | JCAYPWGCOAYTOR-PTJQVGQKSA-N |
| XLogP | 3.38 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|