C22H29BrN2O3 — CID 118276091
3-[3-bromo-4-[1-(cyclopropylmethyl)piperidin-4-yl]oxyphenyl]-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 118276091) has the molecular formula C22H29BrN2O3 and a molecular weight of 449.39 g/mol. Its IUPAC name is 3-[3-bromo-4-[1-(cyclopropylmethyl)piperidin-4-yl]oxyphenyl]-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | 3-[3-bromo-4-[1-(cyclopropylmethyl)piperidin-4-yl]oxyphenyl]-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 118276091 |
| Molecular Formula | C22H29BrN2O3 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 3-[3-bromo-4-[1-(cyclopropylmethyl)piperidin-4-yl]oxyphenyl]-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(OC2CCN(CC3CC3)CC2)c(Br)c1)N1CCOCC1 |
| InChI | InChI=1S/C22H29BrN2O3/c23-20-15-17(4-6-22(26)25-11-13-27-14-12-25)3-5-21(20)28-19-7-9-24(10-8-19)16-18-1-2-18/h3-6,15,18-19H,1-2,7-14,16H2 |
| InChIKey | QAVUXJXDLAHBCF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|