C20H25NO3S — CID 118278040
4-[3-methyl-3-(5-methylsulfonyl-1,3-dihydroisoindol-2-yl)butyl]phenol (PubChem CID 118278040) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is 4-[3-methyl-3-(5-methylsulfonyl-1,3-dihydroisoindol-2-yl)butyl]phenol.
| Compound Name | 4-[3-methyl-3-(5-methylsulfonyl-1,3-dihydroisoindol-2-yl)butyl]phenol |
|---|---|
| PubChem CID | 118278040 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 4-[3-methyl-3-(5-methylsulfonyl-1,3-dihydroisoindol-2-yl)butyl]phenol |
| SMILES | CC(C)(CCc1ccc(O)cc1)N1Cc2ccc(S(C)(=O)=O)cc2C1 |
| InChI | InChI=1S/C20H25NO3S/c1-20(2,11-10-15-4-7-18(22)8-5-15)21-13-16-6-9-19(25(3,23)24)12-17(16)14-21/h4-9,12,22H,10-11,13-14H2,1-3H3 |
| InChIKey | KMGYYALFTIXLMG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |