C21H26ClNO4S — CID 118278060
2-methoxy-4-[3-methyl-3-(5-methylsulfonylisoindol-2-yl)butyl]phenol;hydrochloride (PubChem CID 118278060) has the molecular formula C21H26ClNO4S and a molecular weight of 423.96 g/mol. Its IUPAC name is 2-methoxy-4-[3-methyl-3-(5-methylsulfonylisoindol-2-yl)butyl]phenol;hydrochloride.
| Compound Name | 2-methoxy-4-[3-methyl-3-(5-methylsulfonylisoindol-2-yl)butyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 118278060 |
| Molecular Formula | C21H26ClNO4S |
| Molecular Weight | 423.96 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 2-methoxy-4-[3-methyl-3-(5-methylsulfonylisoindol-2-yl)butyl]phenol;hydrochloride |
| SMILES | COc1cc(CCC(C)(C)n2cc3ccc(S(C)(=O)=O)cc3c2)ccc1O.Cl |
| InChI | InChI=1S/C21H25NO4S.ClH/c1-21(2,10-9-15-5-8-19(23)20(11-15)26-3)22-13-16-6-7-18(27(4,24)25)12-17(16)14-22;/h5-8,11-14,23H,9-10H2,1-4H3;1H |
| InChIKey | NVRJYEICFGNBBL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.96 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |