C24H33NO4S — CID 129161144
2-butoxy-4-[3-methyl-3-(5-methylsulfonyl-1,3-dihydroisoindol-2-yl)butyl]phenol (PubChem CID 129161144) has the molecular formula C24H33NO4S and a molecular weight of 431.60 g/mol. Its IUPAC name is 2-butoxy-4-[3-methyl-3-(5-methylsulfonyl-1,3-dihydroisoindol-2-yl)butyl]phenol.
| Compound Name | 2-butoxy-4-[3-methyl-3-(5-methylsulfonyl-1,3-dihydroisoindol-2-yl)butyl]phenol |
|---|---|
| PubChem CID | 129161144 |
| Molecular Formula | C24H33NO4S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-butoxy-4-[3-methyl-3-(5-methylsulfonyl-1,3-dihydroisoindol-2-yl)butyl]phenol |
| SMILES | CCCCOc1cc(CCC(C)(C)N2Cc3ccc(S(C)(=O)=O)cc3C2)ccc1O |
| InChI | InChI=1S/C24H33NO4S/c1-5-6-13-29-23-14-18(7-10-22(23)26)11-12-24(2,3)25-16-19-8-9-21(30(4,27)28)15-20(19)17-25/h7-10,14-15,26H,5-6,11-13,16-17H2,1-4H3 |
| InChIKey | PFUVIUGMBUJKPA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|