C9H10N2OS — CID 118280400
3-ethyl-6-methylthieno[2,3-d]pyrimidin-4-one (PubChem CID 118280400) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is 3-ethyl-6-methylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-ethyl-6-methylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 118280400 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 3-ethyl-6-methylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCn1cnc2sc(C)cc2c1=O |
| InChI | InChI=1S/C9H10N2OS/c1-3-11-5-10-8-7(9(11)12)4-6(2)13-8/h4-5H,3H2,1-2H3 |
| InChIKey | BGEXHNIJQWRWFM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |