C10H12N2O2S — CID 39760848
3-(2-methoxyethyl)-6-methylthieno[2,3-d]pyrimidin-4-one (PubChem CID 39760848) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-6-methylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(2-methoxyethyl)-6-methylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 39760848 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 3-(2-methoxyethyl)-6-methylthieno[2,3-d]pyrimidin-4-one |
| SMILES | COCCn1cnc2sc(C)cc2c1=O |
| InChI | InChI=1S/C10H12N2O2S/c1-7-5-8-9(15-7)11-6-12(10(8)13)3-4-14-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | KBAIDMVUWZZGLF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |