C10H10N2OS — CID 144895692
6-methyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 144895692) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 6-methyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-methyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 144895692 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 6-methyl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1cnc2sc(C)cc2c1=O |
| InChI | InChI=1S/C10H10N2OS/c1-3-4-12-6-11-9-8(10(12)13)5-7(2)14-9/h3,5-6H,1,4H2,2H3 |
| InChIKey | IJYQFTMAIIZCIP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|