C9H8N2OS — CID 118286876
3-ethenyl-6-methylthieno[2,3-d]pyrimidin-4-one (PubChem CID 118286876) has the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. Its IUPAC name is 3-ethenyl-6-methylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-ethenyl-6-methylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 118286876 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 3-ethenyl-6-methylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=Cn1cnc2sc(C)cc2c1=O |
| InChI | InChI=1S/C9H8N2OS/c1-3-11-5-10-8-7(9(11)12)4-6(2)13-8/h3-5H,1H2,2H3 |
| InChIKey | WOPBJHLADDGOQC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |