About 3-[(2-bromo-4-methyl-1,3-thiazol-5-yl)methyl]-6-methylthieno[2,3-d]pyrimidin-4-one
3-[(2-bromo-4-methyl-1,3-thiazol-5-yl)methyl]-6-methylthieno[2,3-d]pyrimidin-4-one (PubChem CID 166301450) has the molecular formula C12H10BrN3OS2
and a molecular weight of 356.27 g/mol. Its IUPAC name is 3-[(2-bromo-4-methyl-1,3-thiazol-5-yl)methyl]-6-methylthieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[(2-bromo-4-methyl-1,3-thiazol-5-yl)methyl]-6-methylthieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 166301450 |
| Molecular Formula | C12H10BrN3OS2 |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 354.94 |
| IUPAC Name | 3-[(2-bromo-4-methyl-1,3-thiazol-5-yl)methyl]-6-methylthieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cc2c(=O)n(Cc3sc(Br)nc3C)cnc2s1 |
| InChI | InChI=1S/C12H10BrN3OS2/c1-6-3-8-10(18-6)14-5-16(11(8)17)4-9-7(2)15-12(13)19-9/h3,5H,4H2,1-2H3 |
| InChIKey | YMSIHRXCCVXZTJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(2-bromo-4-methyl-1,3-thiazol-5-yl)methyl]-6-methylthieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-bromo-4-methyl-1,3-thiazol-5-yl)methyl]-6-methylthieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 3-[(2-bromo-4-methyl-1,3-thiazol-5-yl)methyl]-6-methylthieno[2,3-d]pyrimidin-4-one (CID 166301450) is 3-[(2-bromo-4-methyl-1,3-thiazol-5-yl)methyl]-6-methylthieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 3-[(2-bromo-4-methyl-1,3-thiazol-5-yl)methyl]-6-methylthieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 3-[(2-bromo-4-methyl-1,3-thiazol-5-yl)methyl]-6-methylthieno[2,3-d]pyrimidin-4-one is Cc1cc2c(=O)n(Cc3sc(Br)nc3C)cnc2s1.
What is the InChIKey of 3-[(2-bromo-4-methyl-1,3-thiazol-5-yl)methyl]-6-methylthieno[2,3-d]pyrimidin-4-one?
The InChIKey is YMSIHRXCCVXZTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrN3OS2/c1-6-3-8-10(18-6)14-5-16(11(8)17)4-9-7(2)15-12(13)19-9/h3,5H,4H2,1-2H3.
What are the key properties of 3-[(2-bromo-4-methyl-1,3-thiazol-5-yl)methyl]-6-methylthieno[2,3-d]pyrimidin-4-one?
3-[(2-bromo-4-methyl-1,3-thiazol-5-yl)methyl]-6-methylthieno[2,3-d]pyrimidin-4-one has a molecular weight of 356.27 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-bromo-4-methyl-1,3-thiazol-5-yl)methyl]-6-methylthieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 166301450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).