C31H39NO7S2 — CID 118282000
tert-butyl 2-[3-[1-[[4-(3-methylsulfonylphenyl)phenyl]sulfonylamino]hexyl]phenoxy]acetate (PubChem CID 118282000) has the molecular formula C31H39NO7S2 and a molecular weight of 601.79 g/mol. Its IUPAC name is tert-butyl 2-[3-[1-[[4-(3-methylsulfonylphenyl)phenyl]sulfonylamino]hexyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[3-[1-[[4-(3-methylsulfonylphenyl)phenyl]sulfonylamino]hexyl]phenoxy]acetate |
|---|---|
| PubChem CID | 118282000 |
| Molecular Formula | C31H39NO7S2 |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | tert-butyl 2-[3-[1-[[4-(3-methylsulfonylphenyl)phenyl]sulfonylamino]hexyl]phenoxy]acetate |
| SMILES | CCCCCC(NS(=O)(=O)c1ccc(-c2cccc(S(C)(=O)=O)c2)cc1)c1cccc(OCC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C31H39NO7S2/c1-6-7-8-15-29(25-12-9-13-26(20-25)38-22-30(33)39-31(2,3)4)32-41(36,37)27-18-16-23(17-19-27)24-11-10-14-28(21-24)40(5,34)35/h9-14,16-21,29,32H,6-8,15,22H2,1-5H3 |
| InChIKey | XRCSOMWGSAEQIH-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|