C24H32O4 — CID 58325712
tert-butyl 2-[3-[4-(3-hydroxyphenyl)hexan-2-yl]phenoxy]acetate (PubChem CID 58325712) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is tert-butyl 2-[3-[4-(3-hydroxyphenyl)hexan-2-yl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[3-[4-(3-hydroxyphenyl)hexan-2-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 58325712 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | tert-butyl 2-[3-[4-(3-hydroxyphenyl)hexan-2-yl]phenoxy]acetate |
| SMILES | CCC(CC(C)c1cccc(OCC(=O)OC(C)(C)C)c1)c1cccc(O)c1 |
| InChI | InChI=1S/C24H32O4/c1-6-18(20-10-7-11-21(25)14-20)13-17(2)19-9-8-12-22(15-19)27-16-23(26)28-24(3,4)5/h7-12,14-15,17-18,25H,6,13,16H2,1-5H3 |
| InChIKey | BJMOARBERHTAHA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |