C32H30N4O2 — CID 118289925
[3-(4-cyanophenyl)-4-methylphenyl] N-[4-(4-benzylpiperazin-1-yl)phenyl]carbamate (PubChem CID 118289925) has the molecular formula C32H30N4O2 and a molecular weight of 502.62 g/mol. Its IUPAC name is [3-(4-cyanophenyl)-4-methylphenyl] N-[4-(4-benzylpiperazin-1-yl)phenyl]carbamate.
| Compound Name | [3-(4-cyanophenyl)-4-methylphenyl] N-[4-(4-benzylpiperazin-1-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 118289925 |
| Molecular Formula | C32H30N4O2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | [3-(4-cyanophenyl)-4-methylphenyl] N-[4-(4-benzylpiperazin-1-yl)phenyl]carbamate |
| SMILES | Cc1ccc(OC(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)cc1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C32H30N4O2/c1-24-7-16-30(21-31(24)27-10-8-25(22-33)9-11-27)38-32(37)34-28-12-14-29(15-13-28)36-19-17-35(18-20-36)23-26-5-3-2-4-6-26/h2-16,21H,17-20,23H2,1H3,(H,34,37) |
| InChIKey | ZHIGOSQWUYAQFR-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|