C9H13NO4 — CID 11830411
(1S,2S,6R)-4,4-dimethyl-3,5,10-trioxa-8-azatricyclo[6.3.0.02,6]undecan-9-one (PubChem CID 11830411) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is (1S,2S,6R)-4,4-dimethyl-3,5,10-trioxa-8-azatricyclo[6.3.0.02,6]undecan-9-one.
| Compound Name | (1S,2S,6R)-4,4-dimethyl-3,5,10-trioxa-8-azatricyclo[6.3.0.02,6]undecan-9-one |
|---|---|
| PubChem CID | 11830411 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (1S,2S,6R)-4,4-dimethyl-3,5,10-trioxa-8-azatricyclo[6.3.0.02,6]undecan-9-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](CN3C(=O)OC[C@@H]23)O1 |
| InChI | InChI=1S/C9H13NO4/c1-9(2)13-6-3-10-5(7(6)14-9)4-12-8(10)11/h5-7H,3-4H2,1-2H3/t5-,6+,7-/m0/s1 |
| InChIKey | PWKNYNYKRYZDDP-XVMARJQXSA-N |
| XLogP | 0.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |