C11H12F2N2 — CID 11830689
(1R,2R,4S)-2-(5,6-difluoro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane (PubChem CID 11830689) has the molecular formula C11H12F2N2 and a molecular weight of 210.23 g/mol. Its IUPAC name is (1R,2R,4S)-2-(5,6-difluoro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,2R,4S)-2-(5,6-difluoro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 11830689 |
| Molecular Formula | C11H12F2N2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (1R,2R,4S)-2-(5,6-difluoro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane |
| SMILES | Fc1cc([C@H]2C[C@@H]3CC[C@H]2N3)cnc1F |
| InChI | InChI=1S/C11H12F2N2/c12-9-3-6(5-14-11(9)13)8-4-7-1-2-10(8)15-7/h3,5,7-8,10,15H,1-2,4H2/t7-,8+,10+/m0/s1 |
| InChIKey | MRUWDSHKKDAQOD-QXFUBDJGSA-N |
| XLogP | 1.97 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|