C11H13FN2 — CID 23955938
(1R,2R,4R)-2-(6-fluoro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane (PubChem CID 23955938) has the molecular formula C11H13FN2 and a molecular weight of 192.24 g/mol. Its IUPAC name is (1R,2R,4R)-2-(6-fluoro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,2R,4R)-2-(6-fluoro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 23955938 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | (1R,2R,4R)-2-(6-fluoro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane |
| SMILES | Fc1ccc([C@H]2C[C@H]3CC[C@H]2N3)cn1 |
| InChI | InChI=1S/C11H13FN2/c12-11-4-1-7(6-13-11)9-5-8-2-3-10(9)14-8/h1,4,6,8-10,14H,2-3,5H2/t8-,9-,10-/m1/s1 |
| InChIKey | DCJIJGZSYBOUGL-OPRDCNLKSA-N |
| XLogP | 1.83 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|