C10H13N3 — CID 10487486
(1R,2R,4S)-2-pyridazin-4-yl-7-azabicyclo[2.2.1]heptane (PubChem CID 10487486) has the molecular formula C10H13N3 and a molecular weight of 175.24 g/mol. Its IUPAC name is (1R,2R,4S)-2-pyridazin-4-yl-7-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,2R,4S)-2-pyridazin-4-yl-7-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 10487486 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | (1R,2R,4S)-2-pyridazin-4-yl-7-azabicyclo[2.2.1]heptane |
| SMILES | c1cc([C@H]2C[C@@H]3CC[C@H]2N3)cnn1 |
| InChI | InChI=1S/C10H13N3/c1-2-10-9(5-8(1)13-10)7-3-4-11-12-6-7/h3-4,6,8-10,13H,1-2,5H2/t8-,9+,10+/m0/s1 |
| InChIKey | NVXUDSHXCARICB-IVZWLZJFSA-N |
| XLogP | 1.08 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |