C17H17FN2 — CID 10901613
(1R,2R,4S)-2-(6-fluoro-5-phenyl-3-pyridinyl)-7-azabicyclo[2.2.1]heptane (PubChem CID 10901613) has the molecular formula C17H17FN2 and a molecular weight of 268.33 g/mol. Its IUPAC name is (1R,2R,4S)-2-(6-fluoro-5-phenyl-3-pyridinyl)-7-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,2R,4S)-2-(6-fluoro-5-phenyl-3-pyridinyl)-7-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 10901613 |
| Molecular Formula | C17H17FN2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (1R,2R,4S)-2-(6-fluoro-5-phenyl-3-pyridinyl)-7-azabicyclo[2.2.1]heptane |
| SMILES | Fc1ncc([C@H]2C[C@@H]3CC[C@H]2N3)cc1-c1ccccc1 |
| InChI | InChI=1S/C17H17FN2/c18-17-15(11-4-2-1-3-5-11)8-12(10-19-17)14-9-13-6-7-16(14)20-13/h1-5,8,10,13-14,16,20H,6-7,9H2/t13-,14+,16+/m0/s1 |
| InChIKey | VJEHPMOIYSUGSJ-SQWLQELKSA-N |
| XLogP | 3.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|