C17H16BrClN2 — CID 75113145
2-[5-(3-bromophenyl)-6-chloro-3-pyridinyl]-7-azabicyclo[2.2.1]heptane (PubChem CID 75113145) has the molecular formula C17H16BrClN2 and a molecular weight of 363.69 g/mol. Its IUPAC name is 2-[5-(3-bromophenyl)-6-chloro-3-pyridinyl]-7-azabicyclo[2.2.1]heptane.
| Compound Name | 2-[5-(3-bromophenyl)-6-chloro-3-pyridinyl]-7-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 75113145 |
| Molecular Formula | C17H16BrClN2 |
| Molecular Weight | 363.69 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 2-[5-(3-bromophenyl)-6-chloro-3-pyridinyl]-7-azabicyclo[2.2.1]heptane |
| SMILES | Clc1ncc(C2CC3CCC2N3)cc1-c1cccc(Br)c1 |
| InChI | InChI=1S/C17H16BrClN2/c18-12-3-1-2-10(6-12)15-7-11(9-20-17(15)19)14-8-13-4-5-16(14)21-13/h1-3,6-7,9,13-14,16,21H,4-5,8H2 |
| InChIKey | AZUKJENWDLWCOX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.69 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|