C17H18ClFN2 — CID 11197491
(1R,2R,4S)-2-(6-fluoro-5-phenyl-3-pyridinyl)-7-azabicyclo[2.2.1]heptane;hydrochloride (PubChem CID 11197491) has the molecular formula C17H18ClFN2 and a molecular weight of 304.80 g/mol. Its IUPAC name is (1R,2R,4S)-2-(6-fluoro-5-phenyl-3-pyridinyl)-7-azabicyclo[2.2.1]heptane;hydrochloride.
| Compound Name | (1R,2R,4S)-2-(6-fluoro-5-phenyl-3-pyridinyl)-7-azabicyclo[2.2.1]heptane;hydrochloride |
|---|---|
| PubChem CID | 11197491 |
| Molecular Formula | C17H18ClFN2 |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (1R,2R,4S)-2-(6-fluoro-5-phenyl-3-pyridinyl)-7-azabicyclo[2.2.1]heptane;hydrochloride |
| SMILES | Cl.Fc1ncc([C@H]2C[C@@H]3CC[C@H]2N3)cc1-c1ccccc1 |
| InChI | InChI=1S/C17H17FN2.ClH/c18-17-15(11-4-2-1-3-5-11)8-12(10-19-17)14-9-13-6-7-16(14)20-13;/h1-5,8,10,13-14,16,20H,6-7,9H2;1H/t13-,14+,16+;/m0./s1 |
| InChIKey | GOSKOUSCEZVFNQ-YJUBXGJFSA-N |
| XLogP | 3.92 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|